- Fmoc-L-Cys(tBu)-OH
-
- $0.00/ kg
-
2026-04-14
- CAS:67436-13-9
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
- Fmoc-Cys(tBu)-OH
-
- $7.00 / 1KG
-
2019-09-02
- CAS:67436-13-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100KG
|
| | Fmoc-Cys(tBu)-OH Basic information |
| | Fmoc-Cys(tBu)-OH Chemical Properties |
| Melting point | 136.0 to 140.0 °C | | Boiling point | 603.4±55.0 °C(Predicted) | | density | 1.237±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | Water Solubility | Soluble in water | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.49±0.10(Predicted) | | form | Crystalline Powder | | color | White | | BRN | 4577031 | | Major Application | peptide synthesis | | InChI | 1S/C22H25NO4S/c1-22(2,3)28-13-19(20(24)25)23-21(26)27-12-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,18-19H,12-13H2,1-3H3,(H,23,26)(H,24,25)/t19-/m0/s1 | | InChIKey | IXAYZHCPEYTWHW-IBGZPJMESA-N | | SMILES | CC(C)(C)SC[C@H](NC(=O)OCC1c2ccccc2-c3ccccc13)C(O)=O | | CAS DataBase Reference | 67436-13-9(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2930 90 16 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | Fmoc-Cys(tBu)-OH Usage And Synthesis |
| Chemical Properties | White solid | | Uses | Fmoc-Cys(tBu)-OH, is an amino acid building block used in peptide synthesis. With a growing peptide drug market the fast, reliable synthesis of peptides is of great importance. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-Cys(tBu)-OH Preparation Products And Raw materials |
|