- 4-Fluorocatechol
-
-
2022-02-21
- CAS:367-32-8
- Min. Order: 1KG
- Purity: 98.1%
- Supply Ability: 100 tons
- 4-Fluorocatechol
-
- $1.00
-
2019-07-14
- CAS:367-32-8
- Min. Order: 1KG
- Purity: 90%-99.9%
- Supply Ability: 100kg
|
| | 4-Fluorocatechol Basic information |
| | 4-Fluorocatechol Chemical Properties |
| Melting point | 90-91 | | Boiling point | 258.0±20.0 °C(Predicted) | | density | 1.415±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Acetone (Slightly), Methanol (Slightly) | | form | Solid | | pka | 8.80±0.10(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C6H5FO2/c7-4-1-2-5(8)6(9)3-4/h1-3,8-9H | | InChIKey | NFWGQJUHSAGJBE-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(F)C=C1O | | CAS DataBase Reference | 367-32-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | RIDADR | 2923 | | Hazard Note | Irritant | | HazardClass | 8 | | PackingGroup | Ⅲ | | HS Code | 2909309090 |
| | 4-Fluorocatechol Usage And Synthesis |
| Definition | ChEBI: 4-Fluorocatechol is a member of catechols. |
| | 4-Fluorocatechol Preparation Products And Raw materials |
|