- 5-CHLORO-2-PICOLINE
-
-
2026-06-30
- CAS:72093-07-3
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
- 5-CHLORO-2-PICOLINE
-
- $1.10
-
2025-11-18
- CAS:72093-07-3
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons min
|
| | 5-CHLORO-2-PICOLINE Basic information |
| Product Name: | 5-CHLORO-2-PICOLINE | | Synonyms: | 5-CHLORO-2-PICOLINE;3-Chloro-6-methylpyridine;5-CHLORO-2-METHYLPYRIDINE (5-CHLORO-2-PICOLINE);5-CHLORO-2-PICOLINE5-CHLORO-2-METHYLPYRIDINE;5-Chloro-3-methylpyridine;2-Methyl-5-chloropyridine;Pyridine, 5-chloro-2-methyl-;5-CHLORO-2-PICOLINE ISO 9001：2015 REACH | | CAS: | 72093-07-3 | | MF: | C6H6ClN | | MW: | 127.57 | | EINECS: | | | Product Categories: | pyridine series;Pyridine;Pyridines | | Mol File: | 72093-07-3.mol |  |
| | 5-CHLORO-2-PICOLINE Chemical Properties |
| Boiling point | 163.0±0.0 °C(Predicted) | | density | 1.150±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 3.67±0.10(Predicted) | | form | Solid or liquid | | Appearance | Colorless to off-white Solid-Liquid Mixture | | InChI | InChI=1S/C6H6ClN/c1-5-2-3-6(7)4-8-5/h2-4H,1H3 | | InChIKey | DEMKNLXJQNYAFY-UHFFFAOYSA-N | | SMILES | C1(C)=NC=C(Cl)C=C1 | | CAS DataBase Reference | 72093-07-3(CAS DataBase Reference) |
| | 5-CHLORO-2-PICOLINE Usage And Synthesis |
| Uses | 5-Chloro-2-picoline is an organic reagent that can be used as a reaction reagent for the synthesis of alkyl-substituted pyridines via directed palladium(II)-catalyzed C-H activation of alkanoic acid amides. It has also been shown to have antitumour activity, inhibiting the growth of tumour cells, thereby preventing DNA replication and transcription. |
| | 5-CHLORO-2-PICOLINE Preparation Products And Raw materials |
|