| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Mono(2-ethyl-5-hydroxyhexyl) Phthalate (Mixture of DiastereoMers) CAS:40321-99-1 Package:2.5Mg,25Mg
|
| Company Name: |
Chemsky(shanghai)International Co.,Ltd.
|
| Tel: |
021-50135380 |
| Email: |
shchemsky@sina.com |
| Products Intro: |
Product Name:Mono(2-ethyl-5-hydroxyhexyl) Phthalate
(Mixture of DiastereoMers) CAS:40321-99-1 Purity:98%
|
| Company Name: |
Finetech Industry Limited
|
| Tel: |
027-87465837 19945049750 |
| Email: |
sales@finetechnology-ind.com |
| Products Intro: |
Product Name:Mono(2-ethyl-5-hydroxyhexyl) Phthalate CAS:40321-99-1 Purity:98% Package:1g,10g,25g,100g,500g,1kg
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:mono-(2-Ethyl-5-hydroxyhexyl) phthalate, mixture of diastereomers CAS:40321-99-1 Purity:analytical standard Package:50MG Remarks:09171-50MG
|
|
| Product Name: | MEHHP | | Synonyms: | mono(2-ethyl-5-hydroxyhexyl) 1,2-benzenedicarboxylate;MEHHP;Mono(2-ethyl-5-hydroxyhexyl) Phthalate
(Mixture of Diastereomers);1,2-Benzenedicarboxylic Acid 1-(2-Ethyl-5-hydroxyhexyl) Ester;1,2-Benzenedicarboxylic Acid Mono(2-ethyl-5-hydroxyhexyl) Ester;5-OH-MEHP;[2H4]-Mono(2-ethyl-5-hydroxyhexyl) Phthalate;Mono(2-ethyl-5-hydroxyhexyl) phthalate (MEHHP) | | CAS: | 40321-99-1 | | MF: | C16H22O5 | | MW: | 294.34 | | EINECS: | | | Product Categories: | Aromatics;Metabolites & Impurities | | Mol File: | 40321-99-1.mol |  |
| | MEHHP Chemical Properties |
| Boiling point | 463.7±30.0 °C(Predicted) | | density | 1.160±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly) | | pka | 3.37±0.36(Predicted) | | form | Oil | | color | Colorless to Brown | | BRN | 9208635 | | Stability: | Hygroscopic | | Major Application | cleaning products cosmetics environmental food and beverages personal care | | InChI | 1S/C16H22O5/c1-3-12(9-8-11(2)17)10-21-16(20)14-7-5-4-6-13(14)15(18)19/h4-7,11-12,17H,3,8-10H2,1-2H3,(H,18,19) | | InChIKey | RYPQSGURZSTFSX-UHFFFAOYSA-N | | SMILES | O=C(OCC(CC)CCC(C)O)C1=CC=CC=C1C(O)=O |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| | MEHHP Usage And Synthesis |
| Chemical Properties | Light Yellow to Brown Oil | | Uses | Phthalate metabolite. | | Definition | ChEBI: A phthalic acid monoester obtained by formal condensation of one of the carboxy groups of phthalic acid with the primary hydroxy group of 2-ethylhexane-1,5-diol |
| | MEHHP Preparation Products And Raw materials |
|