- uv absorber 327
-
-
2026-06-02
- CAS:3864-99-1
- Min. Order: 25KG
- Purity: 98%
- Supply Ability: 20 tons
- UV-327
-
- $5.00
-
2026-05-28
- CAS:3864-99-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000kg
|
| | 2-(2'-Hydroxy-3',5'-di-tert-butylphenyl)-5-chlorobenzotriazole Basic information |
| | 2-(2'-Hydroxy-3',5'-di-tert-butylphenyl)-5-chlorobenzotriazole Chemical Properties |
| Melting point | 150-153 °C(lit.) | | Boiling point | 469.2±55.0 °C(Predicted) | | density | 1,26 g/cm3 | | Fp | 234°C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform, Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Solid | | pka | 9.23±0.48(Predicted) | | color | Off-White to Pale Yellow | | Stability: | Light Sensitive | | InChI | InChI=1S/C20H24ClN3O/c1-19(2,3)12-9-14(20(4,5)6)18(25)17(10-12)24-22-15-8-7-13(21)11-16(15)23-24/h7-11,25H,1-6H3 | | InChIKey | UWSMKYBKUPAEJQ-UHFFFAOYSA-N | | SMILES | C1(O)=C(C(C)(C)C)C=C(C(C)(C)C)C=C1N1N=C2C=C(Cl)C=CC2=N1 | | CAS DataBase Reference | 3864-99-1(CAS DataBase Reference) | | EPA Substance Registry System | 2-(5-Chloro-2H-benzotriazol-2-yl)-4,6-di-tert-butylphenol (3864-99-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | 3077 | | WGK Germany | 2 | | RTECS | 3425000 | | TSCA | TSCA listed | | HazardClass | 9 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 3 STOT RE 2 |
| | 2-(2'-Hydroxy-3',5'-di-tert-butylphenyl)-5-chlorobenzotriazole Usage And Synthesis |
| Uses | 2,4-Di-tert-butyl-6-(5-chloro-2H-benzotriazol-2-yl)phenol is a UV absorber. | | Definition | ChEBI: 5-Chloro-2-(3,5-di-tert-butyl-2-hydroxyphenyl)-2H-benzotriazole is a member of triazoles. |
| | 2-(2'-Hydroxy-3',5'-di-tert-butylphenyl)-5-chlorobenzotriazole Preparation Products And Raw materials |
|