- CHLUMICRYI? DMPT
-
- $0.00 / 1kg
-
2025-04-09
- CAS:131538-00-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20 tons
|
| | 1-Propanethiol,2,3-bis[(2-mercaptoethyl)thio]- Basic information |
| Product Name: | 1-Propanethiol,2,3-bis[(2-mercaptoethyl)thio]- | | Synonyms: | 1,2-Bis[(2-mercaptoethyl)thio]-3-mercaptopropane;4-(Mercaptomethyl)-1,8-dimercapto-3,6-dithiaoctane;1-Propanethiol,2,3-bis[(2-Mercaptoethyl)thio]-;2,3-bis(2-sulfanylethylsulfanyl)propane-1-thiol;Monomer-PETP;YF-FM PETP;4-Mercaptomethyl-3,6-dithia-1,8-octanedithiol;2,3-bis((2-mercaptoethyl)thio)-1-propanethiol | | CAS: | 131538-00-6 | | MF: | C7H16S5 | | MW: | 260.53 | | EINECS: | 411-290-7 | | Product Categories: | | | Mol File: | 131538-00-6.mol | ![1-Propanethiol,2,3-bis[(2-mercaptoethyl)thio]- Structure](CAS/GIF/131538-00-6.gif) |
| | 1-Propanethiol,2,3-bis[(2-mercaptoethyl)thio]- Chemical Properties |
| Boiling point | 395.6±42.0 °C(Predicted) | | density | 1.214 | | vapor pressure | 56.2Pa at 20℃ | | solubility | 13190 in mg/100g standard fat at 20 ℃ | | pka | 9.57±0.10(Predicted) | | Water Solubility | 12mg/L at 20℃ | | InChI | InChI=1S/C7H16S5/c8-1-3-11-6-7(5-10)12-4-2-9/h7-10H,1-6H2 | | InChIKey | CEUQYYYUSUCFKP-UHFFFAOYSA-N | | SMILES | C(S)C(SCCS)CSCCS | | LogP | 3.16 at 25℃ | | EPA Substance Registry System | 1-Propanethiol, 2,3-bis[(2-mercaptoethyl)thio]- (131538-00-6) |
| | 1-Propanethiol,2,3-bis[(2-mercaptoethyl)thio]- Usage And Synthesis |
| Uses | 2,3-bis(2-mercaptoethyl)thio)-1-propanethiol is used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process. | | Flammability and Explosibility | Non flammable |
| | 1-Propanethiol,2,3-bis[(2-mercaptoethyl)thio]- Preparation Products And Raw materials |
|