9,9-Bis[4-(2-acryloyloxyethyloxy)phenyl]fluorene manufacturers
|
| | 9,9-Bis[4-(2-acryloyloxyethyloxy)phenyl]fluorene Basic information |
| Product Name: | 9,9-Bis[4-(2-acryloyloxyethyloxy)phenyl]fluorene | | Synonyms: | 9,9-BIS[4-(2-ACRYLOYLOXYETHYLOXY)PHENYL]FLUORENE;2-Propenoic acid 9H-fluoren-9-ylidene-bis(4,1-phenyleneoxy-2,1-ethanediyl) ester;9,9-Bis[4-2-Acryloloxyethoxy)phenyl] fluorene;9,9-Bis(4-(2-acryloxyethoxy)phenyl)fluorene;(((9H-Fluorene-9,9-diyl)bis(4,1-phenylene))bis(oxy))bis(ethane-2,1-diyl) diacrylate;9,9-BIS[4-(2-ACRYLOYLOXYETHOXY)PHENYL]FLUORENE;(((9H-Fluorene-9,9-diyl);bis(4,1-phenylene) | | CAS: | 161182-73-6 | | MF: | C35H30O6 | | MW: | 546.61 | | EINECS: | | | Product Categories: | | | Mol File: | 161182-73-6.mol | ![9,9-Bis[4-(2-acryloyloxyethyloxy)phenyl]fluorene Structure](CAS/GIF/161182-73-6.gif) |
| | 9,9-Bis[4-(2-acryloyloxyethyloxy)phenyl]fluorene Chemical Properties |
| Boiling point | 671.3±55.0 °C(Predicted) | | density | 1.208 | | storage temp. | Amber Vial, Refrigerator, Under inert atmosphere | | solubility | Chloroform (Sparingly), Methanol (Slightly, Heated, Sonicated) | | form | Oil | | color | Colourless | | Stability: | Light Sensitive | | InChIKey | YCPMSWJCWKUXRH-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(OCCOC(=O)C=C)C=C2)(C2=CC=C(OCCOC(=O)C=C)C=C2)C2=C(C=CC=C2)C2=C1C=CC=C2 | | CAS DataBase Reference | 161182-73-6(CAS DataBase Reference) |
| | 9,9-Bis[4-(2-acryloyloxyethyloxy)phenyl]fluorene Usage And Synthesis |
| Chemical Properties |
9,9-Bis[4-(2-acryloyloxyethyloxy)phenyl]fluorene is a monofunctional, monomeric and optical initiator. It is a bifunctional molecule that can polymerize with other molecules to form polyesters.
| | Uses | (((9H-Fluorene-9,9-diyl)bis(4,1-phenylene))bis(oxy))bis(ethane-2,1-diyl) diacrylate (CAS# 161182-73-6) is a photosensitive compound often found in film curing resins and solutions. | | Application | 9,9-Bis[4-(2-acryloyloxyethyloxy)phenyl]fluorene is a optical initiator, it has been used for the study of liquid crystals as well. |
| | 9,9-Bis[4-(2-acryloyloxyethyloxy)phenyl]fluorene Preparation Products And Raw materials |
|