| Company Name: |
Chem-Stone Co.,Ltd. |
| Tel: |
020-82185713,82185709 13418171485 |
| Email: |
sales@chem-stone.com |
1,4,7,10-Tetraazacyclododecaan-1,4,7-triyltriazijnzuur manufacturers
|
| | 1,4,7,10-Tetraazacyclododecaan-1,4,7-triyltriazijnzuur Basic information |
| Product Name: | 1,4,7,10-Tetraazacyclododecaan-1,4,7-triyltriazijnzuur | | Synonyms: | 1,4,7,10-Tetraazacyclododecane-1,4,7-triacetic acid;2-[4,7-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;1,4,7,10-Tetraazacyclododecane-1,4,7-triacetic acid (DO3A);Gadobutrol Impurity 41;2,2',2''-(1,4,7,10-tetraazacyclododecane-1,4,7-triyl)triacetic acid 2,2,2- trifluoroacetic acid;Gadobutrol Impurity CQ: What is
Gadobutrol Impurity C Q: What is the CAS Number of
Gadobutrol Impurity C;Gadobutrol EP Impurity C Monomer;DO4A | | CAS: | 114873-37-9 | | MF: | C14H26N4O6 | | MW: | 346.38 | | EINECS: | | | Product Categories: | | | Mol File: | 114873-37-9.mol |  |
| | 1,4,7,10-Tetraazacyclododecaan-1,4,7-triyltriazijnzuur Chemical Properties |
| Melting point | 260℃ | | Boiling point | 617.6±55.0 °C(Predicted) | | density | 1.242±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | solubility | soluble in Water | | form | Solid | | pka | 2.46±0.10(Predicted) | | color | Beige Coloured | | InChI | InChI=1S/C14H26N4O6/c19-12(20)9-16-3-1-15-2-4-17(10-13(21)22)6-8-18(7-5-16)11-14(23)24/h15H,1-11H2,(H,19,20)(H,21,22)(H,23,24) | | InChIKey | HHLZCENAOIROSL-UHFFFAOYSA-N | | SMILES | N1(CC(O)=O)CCNCCN(CC(O)=O)CCN(CC(O)=O)CC1 |
| | 1,4,7,10-Tetraazacyclododecaan-1,4,7-triyltriazijnzuur Usage And Synthesis |
| Uses | DONA combines with lanthanides to from lanthanide-azacrown coordination complexes. Also it is reported that DONA can be used as potential contrast agents for magnetic resonance imaging (MRI). This compound can be used to target, treat and diagnose tumors. |
| | 1,4,7,10-Tetraazacyclododecaan-1,4,7-triyltriazijnzuur Preparation Products And Raw materials |
|