| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:BORANE-DIISOPROPYLAMINE
CAS:55124-35-1
Purity:90%（NMR） Package:100g;25g;5g;1G Remarks:NULL
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Diisopropylamine borane
CAS:55124-35-1
Purity:95% Package:5G Remarks:900347-5G
|
|
| | BORANE-DIISOPROPYLAMINE Basic information |
| Product Name: | BORANE-DIISOPROPYLAMINE | | Synonyms: | BORANE-DIISOPROPYLAMINE;borane/ diisopropylamine complex;Diisopropylamine borane 95%;Diisopropylamine borane;(Diisopropylammonio)trihydroborate | | CAS: | 55124-35-1 | | MF: | C6H17BN | | MW: | 114.02 | | EINECS: | | | Product Categories: | | | Mol File: | 55124-35-1.mol |  |
| | BORANE-DIISOPROPYLAMINE Chemical Properties |
| Melting point | 21 °C | | Boiling point | 88°C/1mmHg(lit.) | | density | 0.790 g/mL | | refractive index | n/D1.452 | | Fp | 72℃ | | storage temp. | 2-8°C | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C6H18BN/c1-5(2)8(7)6(3)4/h5-6,8H,1-4,7H3 | | InChIKey | CECHXEJDHZCHDL-UHFFFAOYSA-N | | SMILES | CC(C)[N+]([H])([BH3-])C(C)C |
| RIDADR | 1992 | | WGK Germany | WGK 3 | | HazardClass | 3.2 | | PackingGroup | III | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2 |
| | BORANE-DIISOPROPYLAMINE Usage And Synthesis |
| Uses | DIPAB, together with DCAB, were developed as cost effective and easy to handle borylation reagents by the Pucheault Group at the Universite de Bordeaux. From aryl and vinyl halide electrophiles, you can easily access the boronic acid derivative of your choice, including BF3K, Bpin and MIDAs. | | reaction suitability | reagent type: reductant |
| | BORANE-DIISOPROPYLAMINE Preparation Products And Raw materials |
|