|
|
| | (4S)-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(4- hydroxybenzene) propanoic acid,methyl ester (Landiolol) Basic information | | Uses |
| Product Name: | (4S)-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(4- hydroxybenzene) propanoic acid,methyl ester (Landiolol) | | Synonyms: | (4S)-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(4- hydroxybenzene) propanoic acid,methyl ester (Landiolol);((S)-2,2-Dimethyl-1,3-dioxolan-4-yl)methyl 3-(4-hydroxyphenyl)propanoate;Benzenepropanoic acid, 4-hydroxy-, [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl ester;4-Hydroxybenzenepropanoic acid [(4S)-2,2-diMethyl-1,3-dioxolan-4-yl]Methyl ester;4S)-(2,2-diMethyl-1,3-dioxolan-4-yl)-3-(4-hydroxybenzene) propanoicacid,Methyl ester;Landiolol HCl
PI-1;4-Hydroxybenzenepropanoic acid [(4S)-2,2-dimethyl-1,3;3-(4-hydroxyphenyl)propanoic acid (2,2-dimethyl-1,3-dioxolan-4-yl)methyl ester | | CAS: | 144256-11-1 | | MF: | C15H20O5 | | MW: | 280.32 | | EINECS: | 1806241-263-5 | | Product Categories: | APIs Intermediate | | Mol File: | 144256-11-1.mol |  |
| | (4S)-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(4- hydroxybenzene) propanoic acid,methyl ester (Landiolol) Chemical Properties |
| Boiling point | 409.2±35.0 °C(Predicted) | | density | 1.156 | | storage temp. | 2-8°C | | pka | 9.97±0.15(Predicted) | | InChI | InChI=1S/C15H20O5/c1-15(2)19-10-13(20-15)9-18-14(17)8-5-11-3-6-12(16)7-4-11/h3-4,6-7,13,16H,5,8-10H2,1-2H3/t13-/m1/s1 | | InChIKey | TWMFOGUTFPLVQZ-CYBMUJFWSA-N | | SMILES | C1(CCC(OC[C@@H]2COC(C)(C)O2)=O)=CC=C(O)C=C1 |
| | (4S)-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(4- hydroxybenzene) propanoic acid,methyl ester (Landiolol) Usage And Synthesis |
| Uses | (4S)-(2,2-Dimethyl-1,3-dioxolan-4-yl)-3-(4-hydroxybenzene)propanoicacid,methylester is a useful research chemical compound. | | Chemical Properties | White crystalline powder |
| | (4S)-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(4- hydroxybenzene) propanoic acid,methyl ester (Landiolol) Preparation Products And Raw materials |
|