|
|
| | Silvex methyl ester Basic information |
| Product Name: | Silvex methyl ester | | Synonyms: | Methyl 2-(2,4,5-trichlorophenoxy)propanoate;Methyl 2-(2,4,5-trichlorophenoxy)propionate;methyl2-(2,4,5-trichlorophenoxy)propanoicacid;propanoicacid,2-(2,4,5-trichlorophenoxy)-,methylester;Propionic acid, 2-(2,4,5-trichlorophenoxy)-, methyl ester;methyl 2-(2,4,5-trichlorophenoxy)propionate solution;silvex methyl ester solution;FENOPROP-METHYL ESTER | | CAS: | 4841-20-7 | | MF: | C10H9Cl3O3 | | MW: | 283.54 | | EINECS: | 622-566-3 | | Product Categories: | Alpha sort;Pesticides&Metabolites;Q-ZAlphabetic;S;SA - SM | | Mol File: | 4841-20-7.mol |  |
| | Silvex methyl ester Chemical Properties |
| Boiling point | 337.3±37.0 °C(Predicted) | | density | 1.399±0.06 g/cm3(Predicted) | | Fp | -26 °C | | storage temp. | 2-8°C | | BRN | 2135850 | | InChI | 1S/C10H9Cl3O3/c1-5(10(14)15-2)16-9-4-7(12)6(11)3-8(9)13/h3-5H,1-2H3 | | InChIKey | YTAXYXOJOYIQQO-UHFFFAOYSA-N | | SMILES | COC(=O)C(C)Oc1cc(Cl)c(Cl)cc1Cl |
| | Silvex methyl ester Usage And Synthesis |
| Uses | 2,4,5-TP methyl ester | | Production Methods | Fenoprop-methyl was produced through a classic “ester of an ester” route that mirrored other phenoxy herbicide derivatives of its era. Manufacturers began with technical-grade fenoprop, itself obtained by chlorinating and then etherifying the appropriate phenolic precursor to install the 2-propyl side chain. Once purified, this phenoxy acid was esterified with methanol under controlled, typically acid-catalysed conditions, using heat and continuous removal of water to drive the equilibrium toward the methyl ester while avoiding degradation of the phenoxy structure. | | Mechanism of action | Synthetic auxin affecting nucleic acid biosynthesis and cell elongation. Systemic, selective. | | Pesticide Type | Herbicide; Plant Growth Regulator |
| | Silvex methyl ester Preparation Products And Raw materials |
|