| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Silvex Methyl ester CAS:4841-20-7 Purity:200 ng/μL in Isooctane Package:1ML
|
| Company Name: |
Sichuan Kulinan Technology Co., Ltd
|
| Tel: |
400-1166-196 18981987031 |
| Email: |
cdhxsj@163.com |
| Products Intro: |
Product Name:SILVEX METHYL ESTER CAS:4841-20-7 Purity:99% HPLC Package:10g;50g;100g;500g;1kg;5kg;25kg
|
| Company Name: |
Spectrum Chemical Manufacturing Corp.
|
| Tel: |
021-021-021-67601398-809-809-809 15221380277 |
| Email: |
marketing_china@spectrumchemical.com |
| Products Intro: |
Product Name:SILVEX METHYL ESTER CAS:4841-20-7
|
|
| | SILVEX METHYL ESTER Basic information |
| Product Name: | SILVEX METHYL ESTER | | Synonyms: | SILVEX METHYL ESTER;Methyl 2-(2,4,5-trichlorophenoxy)propanoate;Methyl 2-(2,4,5-trichlorophenoxy)propionate;methyl2-(2,4,5-trichlorophenoxy)propanoicacid;propanoicacid,2-(2,4,5-trichlorophenoxy)-,methylester;Propionic acid, 2-(2,4,5-trichlorophenoxy)-, methyl ester;methyl 2-(2,4,5-trichlorophenoxy)propionate solution;silvex methyl ester solution | | CAS: | 4841-20-7 | | MF: | C10H9Cl3O3 | | MW: | 283.54 | | EINECS: | 622-566-3 | | Product Categories: | Alpha sort;Pesticides&Metabolites;Q-ZAlphabetic;S;SA - SM | | Mol File: | 4841-20-7.mol |  |
| | SILVEX METHYL ESTER Chemical Properties |
| Boiling point | 337.3±37.0 °C(Predicted) | | density | 1.399±0.06 g/cm3(Predicted) | | Fp | -26 °C | | storage temp. | 2-8°C | | BRN | 2135850 | | InChI | 1S/C10H9Cl3O3/c1-5(10(14)15-2)16-9-4-7(12)6(11)3-8(9)13/h3-5H,1-2H3 | | InChIKey | YTAXYXOJOYIQQO-UHFFFAOYSA-N | | SMILES | COC(=O)C(C)Oc1cc(Cl)c(Cl)cc1Cl |
| | SILVEX METHYL ESTER Usage And Synthesis |
| Uses | 2,4,5-TP methyl ester |
| | SILVEX METHYL ESTER Preparation Products And Raw materials |
|