|
|
| | 5-FORMYL-2-FURANCARBOXYLIC ACID Basic information |
| | 5-FORMYL-2-FURANCARBOXYLIC ACID Chemical Properties |
| Melting point | 209 °C | | Boiling point | 356.9±27.0 °C(Predicted) | | density | 1.452±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 2.57±0.10(Predicted) | | color | Tan | | InChI | InChI=1S/C6H4O4/c7-3-4-1-2-5(10-4)6(8)9/h1-3H,(H,8,9) | | InChIKey | SHNRXUWGUKDPMA-UHFFFAOYSA-N | | SMILES | O1C(C=O)=CC=C1C(O)=O | | CAS DataBase Reference | 13529-17-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36-36/38 | | Safety Statements | 26-24/25 | | WGK Germany | WGK 3 | | HS Code | 29321900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | 5-FORMYL-2-FURANCARBOXYLIC ACID Usage And Synthesis |
| Chemical Properties | Tan Solid | | Uses | 5-Formylfuran-2-carboxylic Acid is a compound useful in organic synthesis. | | Definition | ChEBI: 5-formyl-2-furoic acid is a member of the class of furoic acids that is 2-furoic acid substituted at position 5 by a formyl group. It is a furoic acid, an arenecarbaldehyde and an aldehydic acid. It is a conjugate acid of a 5-formyl-2-furoate. |
| | 5-FORMYL-2-FURANCARBOXYLIC ACID Preparation Products And Raw materials |
|