|
|
| | 3-Fluoro-6-bromo-2-pyridinecarboxaldehyde Basic information |
| | 3-Fluoro-6-bromo-2-pyridinecarboxaldehyde Chemical Properties |
| Boiling point | 228.6±35.0 °C(Predicted) | | density | 1.778±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | -1.47±0.10(Predicted) | | color | Pale yellow | | InChI | InChI=1S/C6H3BrFNO/c7-6-2-1-4(8)5(3-10)9-6/h1-3H | | InChIKey | BFBRCFKSFRYJGE-UHFFFAOYSA-N | | SMILES | C1(C=O)=NC(Br)=CC=C1F |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-Fluoro-6-bromo-2-pyridinecarboxaldehyde Usage And Synthesis |
| Uses | 3-Fluoro-6-bromo-2-pyridinecarboxaldehyde is an organic compound commonly used in organic synthesis reactions as a chemical reagent. |
| | 3-Fluoro-6-bromo-2-pyridinecarboxaldehyde Preparation Products And Raw materials |
|