|
|
| | 3-hydroxy- α-oxoadamantane-1-acetic acid Basic information |
| Product Name: | 3-hydroxy- α-oxoadamantane-1-acetic acid | | Synonyms: | 3-hydroxy- α-oxoadamantane-1-acetic acid;6. 3-hydroxy- α-oxoadamantane-1-acetic acid;2-(3-Hydroxy-1-adamantyl)-2-oxoacetic acid;3-Hydroxy-alpha-oxotricyclo[3.3.1.13,7]decane-1-acetic acid;2-(3-HydroxyadaMantan-1-yl)-2-oxoacetic acid;Tricyclo[3.3.1.13,7]decane-1-aceticacid, 3-hydroxy-a-oxo-;Saxagliptin INT 4;hydroxy-α-oxoadamantane-1-acetic acid | | CAS: | 709031-28-7 | | MF: | C12H16O4 | | MW: | 224.26 | | EINECS: | 615-199-5 | | Product Categories: | | | Mol File: | 709031-28-7.mol |  |
| | 3-hydroxy- α-oxoadamantane-1-acetic acid Chemical Properties |
| Melting point | 164-165 ºC | | Boiling point | 366.5±21.0 °C(Predicted) | | density | 1.477 | | storage temp. | 2-8°C | | pka | 2.54±0.54(Predicted) | | InChI | InChI=1S/C12H16O4/c13-9(10(14)15)11-2-7-1-8(3-11)5-12(16,4-7)6-11/h7-8,16H,1-6H2,(H,14,15) | | InChIKey | UDKIRRNUAXWHTO-UHFFFAOYSA-N | | SMILES | C(C12CC3CC(CC(C3)(O)C1)C2)(=O)C(=O)O |
| | 3-hydroxy- α-oxoadamantane-1-acetic acid Usage And Synthesis |
| Uses | 2-(3-Hydroxyadamantan-1-yl)-2-oxoacetic Acid can be used as reactant/reagent for preparation method of saxagliptin intermediate (S)-N-tert-butoxycarbonyl-3-hydroxy-1-adamantyl-D-glycine by enzymic synthesis in presence of aminotransferase. |
| | 3-hydroxy- α-oxoadamantane-1-acetic acid Preparation Products And Raw materials |
|