|
|
| | 5-tert-Butylnicotinic acid Basic information | | Application |
| | 5-tert-Butylnicotinic acid Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H13NO2/c1-10(2,3)8-4-7(9(12)13)5-11-6-8/h4-6H,1-3H3,(H,12,13) | | InChIKey | LFFKLILKZSVRJV-UHFFFAOYSA-N | | SMILES | C1=NC=C(C(C)(C)C)C=C1C(O)=O |
| | 5-tert-Butylnicotinic acid Usage And Synthesis |
| Application | 5-tert-butylpyridinecarboxylic acid can be used as an organic synthesis intermediate and a pharmaceutical intermediate, and can be used in laboratory research and development processes as well as in chemical and pharmaceutical production processes. |
| | 5-tert-Butylnicotinic acid Preparation Products And Raw materials |
|