| Company Name: |
Heterochem |
| Tel: |
027-88041443 13072715837 |
| Email: |
sales@hetero-chem.com |
|
| | tert-butyl 2-(4-bromophenyl)acetate Basic information |
| Product Name: | tert-butyl 2-(4-bromophenyl)acetate | | Synonyms: | tert-butyl 2-(4-bromophenyl)acetate;Benzeneacetic acid, 4-broMo-, 1,1-diMethylethyl ester;147196;Tert-Butyl 2-(4-Bromophenyl)acetat;5-methyl-2-(thiophen-2-yl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine;2-(4-bromophenyl)acetic acidtertbutyl ester | | CAS: | 33155-58-7 | | MF: | C12H15BrO2 | | MW: | 271.15 | | EINECS: | | | Product Categories: | | | Mol File: | 33155-58-7.mol |  |
| | tert-butyl 2-(4-bromophenyl)acetate Chemical Properties |
| Boiling point | 305.7±17.0 °C(Predicted) | | density | 1.303±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C12H15BrO2/c1-12(2,3)15-11(14)8-9-4-6-10(13)7-5-9/h4-7H,8H2,1-3H3 | | InChIKey | ZMSZCAZHKBNPDV-UHFFFAOYSA-N | | SMILES | C1(CC(OC(C)(C)C)=O)=CC=C(Br)C=C1 |
| | tert-butyl 2-(4-bromophenyl)acetate Usage And Synthesis |
| Uses | tert-Butyl 2-(4-Bromophenyl)acetate is used as a reactant in the preparation of thiophene-containing biaryl amide derivatives as glucagon receptor antagonists. |
| | tert-butyl 2-(4-bromophenyl)acetate Preparation Products And Raw materials |
|