1,8-Diazido-3,5-dioxaoctane manufacturers
- Azido-PEG2-azide
-
- $50.00
-
2026-05-11
- CAS:59559-06-7
- Purity: 98.42%
- Supply Ability: 10g
- N3-PEG2-N3
-
-
2025-06-07
- CAS:59559-06-7
- Min. Order: 1g
- Purity: >98.00%
- Supply Ability: 1g
|
| | 1,8-Diazido-3,5-dioxaoctane Basic information |
| Product Name: | 1,8-Diazido-3,5-dioxaoctane | | Synonyms: | 1,2-Bis(2-azidoethoxy)ethane;1,8-Diazido-3,5-dioxaoctane;1-Azido-2-[2-(2-azidoethoxy)ethoxy]ethane;1,8-Diazido-3,6-dioxaoctane;Azide-PEG3-Azide;PROTAC Linkers,Inhibitor,Azido PEG2 azide,AzidoPEG2azide,inhibit,Azido-PEG-2-azide;Azido-PEG2-azide, 10 mM in DMSO;N3-PEG2-CH2CH2N3 | | CAS: | 59559-06-7 | | MF: | C6H12N6O2 | | MW: | 200.2 | | EINECS: | | | Product Categories: | All Aliphatics;Aliphatics;Cross Linking Reagents | | Mol File: | 59559-06-7.mol |  |
| | 1,8-Diazido-3,5-dioxaoctane Chemical Properties |
| Boiling point | 8 °C(Press: 0.3 Torr) | | density | 1.15 g/mL | | refractive index | n20/D 1.47 | | storage temp. | 2-8°C | | solubility | Chloroform, Methanol | | form | liquid | | color | Clear Colorless | | Appearance | colorlessoryellowish liquid | | InChI | 1S/C6H12N6O2/c7-11-9-1-3-13-5-6-14-4-2-10-12-8/h1-6H2 | | InChIKey | OHZGAFKSAANFAS-UHFFFAOYSA-N | | SMILES | [N-]=[N+]=NCCOCCOCCN=[N+]=[N-] |
| WGK Germany | WGK 3 | | Storage Class | 5.2 - Organic peroxides and self-reacting hazardous materials | | Hazard Classifications | Self-react. C |
| | 1,8-Diazido-3,5-dioxaoctane Usage And Synthesis |
| Description | PEG3 (triethylene glycol) diazide (1,8-diazido-3,6-dioxaoctane) is a symmetrical bifunctional crosslinker bearing two azide groups. | | Chemical Properties | Clear Colorless Liquid | | Uses | Multifunctional alkylating agent. | | IC 50 | PEGs |
| | 1,8-Diazido-3,5-dioxaoctane Preparation Products And Raw materials |
|