|
|
| | (S)-(+)-4-METHYL-2-PENTANOL Basic information |
| | (S)-(+)-4-METHYL-2-PENTANOL Chemical Properties |
| Boiling point | 138 °C(lit.) | | density | 0.802 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.4790(lit.) | | Fp | 106 °F | | storage temp. | Flammables area | | pka | 15.31±0.20(Predicted) | | form | Liquid | | color | Clear colorless | | Specific Gravity | 0.802 | | Water Solubility | Slightly soluble in water. Soluble in alcohol. | | BRN | 1718991 | | InChI | InChI=1S/C6H14O/c1-5(2)4-6(3)7/h5-7H,4H2,1-3H3/t6-/m0/s1 | | InChIKey | WVYWICLMDOOCFB-LURJTMIESA-N | | SMILES | C[C@H](O)CC(C)C | | LogP | 1.546 (est) |
| Hazard Codes | Xi,Xn | | Risk Statements | 10-37-66-20 | | Safety Statements | 24/25-46 | | RIDADR | UN 2053 3/PG 3 | | WGK Germany | 1 | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29051900 |
| | (S)-(+)-4-METHYL-2-PENTANOL Usage And Synthesis |
| Chemical Properties | Clear colorless liquid | | Uses | It is employed in the reaction of 2-methoxyethyl acetals with allylsilanes in the presence of titanium tetrachloride: regioselective carbon-oxygen bond cleavage of the unsymmetrical acetals. |
| | (S)-(+)-4-METHYL-2-PENTANOL Preparation Products And Raw materials |
|