|
|
| | 2-BROMO-4-NITRO-1,3,5-TRIMETHYLBENZENE Basic information |
| Product Name: | 2-BROMO-4-NITRO-1,3,5-TRIMETHYLBENZENE | | Synonyms: | 1-BROMO-3-NITRO-2,4,6-TRIMETHYLBENZENE;4-BROMO-2-NITROMESITYLENE;3-BROMO-2,4,6-TRIMETHYLNITROBENZENE;2-BROMO-4-NITRO-1,3,5-TRIMETHYLBENZENE;2-Bromo-4-nitromesitylene~3-Bromo-2,4,6-trimethylnitrobenzene;2-Bromo-4-nitromesitylene;2-Bromo-1,3,5-trimethyl-4-nitrobenzene;2-BroMo-1,3,5-triMethyl-4-nitrobenzene, 90+% | | CAS: | 90561-85-6 | | MF: | C9H10BrNO2 | | MW: | 244.09 | | EINECS: | | | Product Categories: | | | Mol File: | 90561-85-6.mol |  |
| | 2-BROMO-4-NITRO-1,3,5-TRIMETHYLBENZENE Chemical Properties |
| Melting point | 59-64 °C(lit.) | | Boiling point | 106-107 °C1.3 mm Hg(lit.) | | density | 1.467±0.06 g/cm3(Predicted) | | Fp | 106-107°C/1.3mm | | storage temp. | 2-8°C | | form | solid | | Sensitive | Light Sensitive | | BRN | 1958703 | | InChI | 1S/C9H10BrNO2/c1-5-4-6(2)9(11(12)13)7(3)8(5)10/h4H,1-3H3 | | InChIKey | IUFDRRDWXUSFBG-UHFFFAOYSA-N | | SMILES | Cc1cc(C)c(c(C)c1Br)[N+]([O-])=O | | CAS DataBase Reference | 90561-85-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | LIGHT SENSITIVE | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-BROMO-4-NITRO-1,3,5-TRIMETHYLBENZENE Usage And Synthesis |
| | 2-BROMO-4-NITRO-1,3,5-TRIMETHYLBENZENE Preparation Products And Raw materials |
|