|
|
| | 4-(Benzyloxy)pyridine N-oxide Basic information |
| | 4-(Benzyloxy)pyridine N-oxide Chemical Properties |
| Melting point | 178-179 °C (dec.)(lit.) | | Boiling point | 415.3±20.0 °C(Predicted) | | density | 1.09±0.1 g/cm3(Predicted) | | pka | 2.25±0.10(Predicted) | | BRN | 165005 | | InChI | 1S/C12H11NO2/c14-13-8-6-12(7-9-13)15-10-11-4-2-1-3-5-11/h1-9H,10H2 | | InChIKey | SUSQPKJQYWTFPU-UHFFFAOYSA-N | | SMILES | [O-][n+]1ccc(OCc2ccccc2)cc1 | | CAS DataBase Reference | 2683-66-1(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36-36/37/39 | | WGK Germany | 3 | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-(Benzyloxy)pyridine N-oxide Usage And Synthesis |
| Chemical Properties | White to off-white crystalline powder | | Uses | 4-Benzyloxypyridine N-Oxide is an intermediate in the synthesis of 4-Hydroxy-1-methyl-2-pyridone (H947715), a reactant used in the synthesis of 3-deaza-3-halouracil nucleosides with cytostatic activity in three cancer cell lines. | | General Description | 4-(Benzyloxy)pyridine N-oxide is a 4-substituted pyridine-1-oxide. It undergoes hydrogenation over palladium to afford pyridine. It participates in the stereoselective synthesis of substituted pyridines, piperidines and piperazines. |
| | 4-(Benzyloxy)pyridine N-oxide Preparation Products And Raw materials |
|