| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Hop-22(29)-ene solution CAS:1615-91-4
|
|
| | HOP-22(29)-ENE Basic information |
| Product Name: | HOP-22(29)-ENE | | Synonyms: | HOP-22(29)-ENE;Hop-22(29)-ene solution;18α-Methyl-22α-(1-methylethenyl)-20,28,29,30-tetranor-5α-lupane;5α-Hop-22(29)-ene;Hopene;(3S,3aS,5aR,5bR,7aS,11aS,11bR,13aR,13bS)-3-isopropenyl-5a,5b,8,8,11a,13b-hexamethyl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysene;(3S,3aS,5aR,5bR,7aS,11aS,11bR,13aR,13bS)-5a,5b,8,8,11a,13b-hexamethyl-3-prop-1-en-2-yl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysene;Hop-22(29)-ene (17β(H),21β(H)) | | CAS: | 1615-91-4 | | MF: | C30H50 | | MW: | 410.72 | | EINECS: | 208-759-1 | | Product Categories: | | | Mol File: | 1615-91-4.mol |  |
| | HOP-22(29)-ENE Chemical Properties |
| Melting point | 151 °C(Solv: acetone (67-64-1); methanol (67-56-1)) | | Boiling point | 458.7±12.0 °C(Predicted) | | density | 0.934±0.06 g/cm3(Predicted) | | Fp | -12℃ | | storage temp. | −20°C | | Major Application | food and beverages | | InChIKey | HHXYJYBYNZMZKX-PYQRSULMSA-N | | SMILES | [H][C@@]12CC[C@]3(C)[C@]([H])(CC[C@]4([H])[C@@]5(C)CCCC(C)(C)[C@]5([H])CC[C@@]34C)[C@@]1(C)CC[C@@H]2C(C)=C | | EPA Substance Registry System | A'-Neogammacer-22(29)-ene (1615-91-4) |
| Hazard Codes | F,Xn,N | | Risk Statements | 11-38-50/53-65-67 | | Safety Statements | 60-61-62-33-29-16-9 | | RIDADR | UN 1262 3/PG 2 | | WGK Germany | 1 | | F | 10-23 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Asp. Tox. 1 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| | HOP-22(29)-ENE Usage And Synthesis |
| Uses | Hop-22(29)-ene can be useful in the study of marine and terrestrial nitrifying bacteria as sources of diverse bacteriohopanepolyols. | | Definition | ChEBI: A triterpene consisting of hopane having a C2C double bond at the 22(29)-position. |
| | HOP-22(29)-ENE Preparation Products And Raw materials |
|