|
|
| | 2-Nitro-4-(trifluoromethoxy)aniline Basic information |
| Product Name: | 2-Nitro-4-(trifluoromethoxy)aniline | | Synonyms: | 2-NITRO-4-(TRIFLUOROMETHOXY)ANILINE;2-Nitro-4-(trifluoromethoxy)aniline 97%;2-Nitro-4-(trifluoromethoxy)aniline97%;1-Amino-2-nitro-4-(trifluoromethoxy)benzene;3-Nitro-4-aminotrifluoromethoxybenzene;2-Amino-5-(trifluoromethoxy)nitrobenzene, 4-Amino-3-nitro-alpha,alpha,alpha-trifluoroanisole;2-Nitro-4-(trifluoromethoxy)aniline>Benzenamine, 2-nitro-4-(trifluoromethoxy)- | | CAS: | 2267-23-4 | | MF: | C7H5F3N2O3 | | MW: | 222.12 | | EINECS: | | | Product Categories: | Fluorine series | | Mol File: | 2267-23-4.mol |  |
| | 2-Nitro-4-(trifluoromethoxy)aniline Chemical Properties |
| Melting point | 62 °C | | Boiling point | 284.3±35.0 °C(Predicted) | | density | 1.543±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | form | powder to crystal | | pka | -1.38±0.10(Predicted) | | color | Light yellow to Brown | | Sensitive | Light Sensitive | | InChI | InChI=1S/C7H5F3N2O3/c8-7(9,10)15-4-1-2-5(11)6(3-4)12(13)14/h1-3H,11H2 | | InChIKey | YCGFVAPIBALHRT-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(OC(F)(F)F)C=C1[N+]([O-])=O | | CAS DataBase Reference | 2267-23-4(CAS DataBase Reference) |
| | 2-Nitro-4-(trifluoromethoxy)aniline Usage And Synthesis |
| Uses | 2-Nitro-4-(trifluoromethoxy)aniline can be used as arthropodicides. |
| | 2-Nitro-4-(trifluoromethoxy)aniline Preparation Products And Raw materials |
|