|
|
| | 1-Methyl-4-cyano-5-amino-1,2-pyrazole Basic information |
| | 1-Methyl-4-cyano-5-amino-1,2-pyrazole Chemical Properties |
| Melting point | 221-223°C | | Boiling point | 342.4±27.0 °C(Predicted) | | density | 1.32±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | DMSO, Methanol | | form | Solid | | pka | 0.50±0.10(Predicted) | | color | Off-White to Pale Beige | | InChI | InChI=1S/C5H6N4/c1-9-5(7)4(2-6)3-8-9/h3H,7H2,1H3 | | InChIKey | MZFBWODPTSTYAI-UHFFFAOYSA-N | | SMILES | N1(C)C(N)=C(C#N)C=N1 | | CAS DataBase Reference | 5334-41-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2933199090 |
| | 1-Methyl-4-cyano-5-amino-1,2-pyrazole Usage And Synthesis |
| Chemical Properties | Off-White Crystalline Solid | | Uses | An interesting synthetic intermediate |
| | 1-Methyl-4-cyano-5-amino-1,2-pyrazole Preparation Products And Raw materials |
|