|
|
| | 3-(4-Chlorobenzoyl)propionic acid Basic information | | Uses |
| | 3-(4-Chlorobenzoyl)propionic acid Chemical Properties |
| Melting point | 128-130 °C (lit.) | | Boiling point | 305.28°C (rough estimate) | | density | 1.2781 (rough estimate) | | refractive index | 1.5470 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | water: insoluble(lit.) | | form | powder to crystal | | pka | 4.44±0.17(Predicted) | | color | White to Orange to Green | | Water Solubility | Insoluble | | BRN | 2104409 | | InChI | InChI=1S/C10H9ClO3/c11-8-3-1-7(2-4-8)9(12)5-6-10(13)14/h1-4H,5-6H2,(H,13,14) | | InChIKey | AHVASTJJVAYFPY-UHFFFAOYSA-N | | SMILES | C1(C=CC(Cl)=CC=1)C(=O)CCC(=O)O | | CAS DataBase Reference | 3984-34-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-37-26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29183000 | | Storage Class | 11 - Combustible Solids |
| | 3-(4-Chlorobenzoyl)propionic acid Usage And Synthesis |
| Uses | NSC 5137, an aryl chloride, was studied in Pd-mediated Suzuki-Miyaura cross-coupling reactions with arylboronic acids, involving nucleophilic N-heterocyclic carbenes as ancilliary ligands. | | Chemical Properties | white to beige crystalline powder | | Uses | NSC 5137, an aryl chloride, was studied in Pd-mediated Suzuki-Miyaura cross-coupling reactions with arylboronic acids, involving nucleophilic N-heterocyclic carbenes as ancilliary ligands. |
| | 3-(4-Chlorobenzoyl)propionic acid Preparation Products And Raw materials |
|