|
|
| | 4,4'-Bis(chloromethyl)-1,1'-biphenyl Basic information |
| Product Name: | 4,4'-Bis(chloromethyl)-1,1'-biphenyl | | Synonyms: | 4,4'-BIS(CHLOROMETHYL)-1,1'-BIPHENYL, 95 %;4,4'-bis(Chloromethyl)-1,1'-Bi;4,4-Dichloride-methyl-bispheny;BCMB 4,4-bis(Chloromethyl)-Biphenyl;4,4'-Bis(cnloromethyl)diphonyl;4,4''-BIS(CHLOROMETHYL)-1,1''-BIPHENYL 95%;4,4Dichloromethylbiphenyl;3-cyclohexylpropanoic acid propyl ester | | CAS: | 1667-10-3 | | MF: | C14H12Cl2 | | MW: | 251.15 | | EINECS: | 216-784-4 | | Product Categories: | Aryl;C13 to C37+;Halogenated Hydrocarbons;Biphenyl & Diphenyl ether;Biphenyls (for High-Performance Polymer Research);Functional Materials;Reagent for High-Performance Polymer Research;Intermediates of Dyes and Pigments;Biphenyl series | | Mol File: | 1667-10-3.mol |  |
| | 4,4'-Bis(chloromethyl)-1,1'-biphenyl Chemical Properties |
| Melting point | 126 °C (dec.)(lit.) | | Boiling point | 184 °C / 0.2mmHg | | density | 1.195±0.06 g/cm3(Predicted) | | vapor pressure | 4.6Pa at 20℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in Tetrahydrofuran | | form | powder to crystal | | color | White to Light yellow | | Water Solubility | 200ng/L at 20℃ | | InChI | InChI=1S/C14H12Cl2/c15-9-11-1-5-13(6-2-11)14-7-3-12(10-16)4-8-14/h1-8H,9-10H2 | | InChIKey | INZDTEICWPZYJM-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(CCl)C=C2)=CC=C(CCl)C=C1 | | LogP | 4.61 at 25℃ | | CAS DataBase Reference | 1667-10-3(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HS Code | 29039990 |
| | 4,4'-Bis(chloromethyl)-1,1'-biphenyl Usage And Synthesis |
| Chemical Properties | White to light brown solid | | Uses | 4,4'-Bis(chloromethyl)-1,1'-biphenyl is used as a reagent in the synthesis of new double quaternary ammonium salts containing a biphenyl moiety, which have antimicrobial and antifungal activity. | | Flammability and Explosibility | Not classified |
| | 4,4'-Bis(chloromethyl)-1,1'-biphenyl Preparation Products And Raw materials |
|