| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-bromo-2-tert-butylphenylamine Basic information |
| Product Name: | 4-bromo-2-tert-butylphenylamine | | Synonyms: | 4-bromo-2-tert-butylphenylamine;2-tert-butyl-4-bromobenzenamine;5-bromo-3-chloro-2-hydrazinylpyrazine;Benzenamine, 4-bromo-2-(1,1-dimethylethyl)-;4-bromo-2-tert-butylaniline hydrochloride;2-(tert-Butyl)-4-bromoaniline;4-bromo-2-(tert-butyl)aniline;4-bromo-3-(tert-butyl)aniline | | CAS: | 850012-44-1 | | MF: | C10H14BrN | | MW: | 228.13 | | EINECS: | | | Product Categories: | | | Mol File: | 850012-44-1.mol |  |
| | 4-bromo-2-tert-butylphenylamine Chemical Properties |
| Boiling point | 146-147 °C(Press: 9 Torr) | | density | 1.306±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 3.08±0.10(Predicted) | | form | Oil | | color | Light Yellow | | InChI | InChI=1S/C10H14BrN/c1-10(2,3)8-6-7(11)4-5-9(8)12/h4-6H,12H2,1-3H3 | | InChIKey | MRHVSOBPZBXNEB-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(Br)C=C1C(C)(C)C |
| | 4-bromo-2-tert-butylphenylamine Usage And Synthesis |
| Uses | 4-Bromo-2-tert-butylaniline is an intermediate in the synthesis of 1-(2-tert-Butyl-4-bromophenyl)pyrrolidin-2-one (T135885), which is an intermediate in the preparation of [1,1'':3'',1'''']terphenyl-4-carboxylic acid and esters as ligands modulating retinoic acid receptors (RAR). | | Synthesis | 4-Bromo-2-tert-butylaniline is an organic compound that can be synthesized by a variety of methods, including the reaction of 4-bromoaniline with tert-butyl chloride in the presence of a Lewis acid catalyst. |
| | 4-bromo-2-tert-butylphenylamine Preparation Products And Raw materials |
|