|
|
| | METHYL 4-METHYLAMINOBENZOATE Basic information |
| Product Name: | METHYL 4-METHYLAMINOBENZOATE | | Synonyms: | Benzoic acid, 4-(methylamino)-, methyl ester;p-Aminobenzoic acid di-methyl derivative;4-(METHYLAMINO)-BENZOIC ACID METHYL ESTER;METHYL 4-METHYLAMINOBENZOATE;METHYL 4-(N-METHYLAMINO)BENZOATE;METHYL 4-(AMINOMETHYL)-2-CHLOROBENZOATE;Methyl 4-methylaminobenzoate ,98%;Methyl-(4-MerthylaMino)benzoate | | CAS: | 18358-63-9 | | MF: | C9H11NO2 | | MW: | 165.19 | | EINECS: | | | Product Categories: | Aromatic Esters | | Mol File: | 18358-63-9.mol |  |
| | METHYL 4-METHYLAMINOBENZOATE Chemical Properties |
| Melting point | 94-96°C | | Boiling point | 277.5±23.0 °C(Predicted) | | density | 1.125±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 2.26±0.12(Predicted) | | color | White to Light Brown | | Water Solubility | It is slightly soluble in water. (1.2 g/L) (25°C insoluble in hexane. | | BRN | 2803327 | | InChI | InChI=1S/C9H11NO2/c1-10-8-5-3-7(4-6-8)9(11)12-2/h3-6,10H,1-2H3 | | InChIKey | LLAMGYUWYUMHCH-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=C(NC)C=C1 | | CAS DataBase Reference | 18358-63-9(CAS DataBase Reference) |
| HazardClass | IRRITANT | | HS Code | 2916310090 |
| Provider | Language |
|
ALFA
| English |
| | METHYL 4-METHYLAMINOBENZOATE Usage And Synthesis |
| Uses | Methyl 4-(Methylamino)benzoate is used as a reagent in the synthesis of sulfonamide-containing N-hydroxyindole-2-carboxylates as inhibitors of human lactate dehydrogenase-isoform 5. Also used in the preparation of hyaluronic acid-methotrexate conjugates as antiarthritic and antiinflammatory agents.This compound is suitable for lactate dehydrogenase (LDH) related research. |
| | METHYL 4-METHYLAMINOBENZOATE Preparation Products And Raw materials |
|