|
|
| | 4-(trans-4-Propylcyclohexyl)phenol Basic information |
| | 4-(trans-4-Propylcyclohexyl)phenol Chemical Properties |
| Melting point | 138°C(lit.) | | Boiling point | 339.8±21.0 °C(Predicted) | | density | 0.978±0.06 g/cm3(Predicted) | | vapor pressure | 0.002Pa at 25℃ | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 10.21±0.30(Predicted) | | color | White to Light yellow | | Water Solubility | 125μg/L at 20℃ | | InChI | InChI=1S/C15H22O/c1-2-3-12-4-6-13(7-5-12)14-8-10-15(16)11-9-14/h8-13,16H,2-7H2,1H3/t12-,13- | | InChIKey | AHAZEMSUUYFDMM-JOCQHMNTSA-N | | SMILES | C1(O)=CC=C([C@@H]2CC[C@@H](CCC)CC2)C=C1 | | LogP | 5 at 40℃ | | CAS DataBase Reference | 81936-33-6(CAS DataBase Reference) |
| | 4-(trans-4-Propylcyclohexyl)phenol Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | Intermediates of Liquid Crystals | | Flammability and Explosibility | Not classified |
| | 4-(trans-4-Propylcyclohexyl)phenol Preparation Products And Raw materials |
|