- Isopropylboronic acid
-
- $10.00 / 1KG
-
2026-03-20
- CAS:80041-89-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- Isopropylboronic acid
-
- $1.00 / 1KG
-
2019-07-06
- CAS:80041-89-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: Customized
|
| | Isopropylboronic acid Basic information |
| | Isopropylboronic acid Chemical Properties |
| Melting point | 95-100 °C (lit.) | | Boiling point | 160.4±23.0 °C(Predicted) | | density | 0.921±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | Flakes | | pka | 10.49±0.43(Predicted) | | color | White | | Water Solubility | Soluble in water. | | Sensitive | Hygroscopic | | BRN | 1731883 | | InChI | InChI=1S/C3H9BO2/c1-3(2)4(5)6/h3,5-6H,1-2H3 | | InChIKey | QIPHSSYCQCBJAX-UHFFFAOYSA-N | | SMILES | B(C(C)C)(O)O | | CAS DataBase Reference | 80041-89-0(CAS DataBase Reference) |
| | Isopropylboronic acid Usage And Synthesis |
| Chemical Properties | White flakes | | Uses | Isopropylboronic acid as a reagent is involved in copper-promoted cross-coupling, Domino Heck-Suzuki reactions, Suzuki-Miyaura type couple reactions and alkylation-hydride reduction sequence. |
| | Isopropylboronic acid Preparation Products And Raw materials |
|