|
|
| | 5-Fluoro-1,3-isobenzofurandione Basic information |
| | 5-Fluoro-1,3-isobenzofurandione Chemical Properties |
| Melting point | 75-79 °C (lit.) | | Boiling point | 148°C 20mm | | density | 1.55 | | Fp | >93°C | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | Soluble in sodium hydroxide. | | form | powder to crystal | | color | White to Almost white | | Sensitive | Moisture Sensitive | | BRN | 131281 | | InChI | InChI=1S/C8H3FO3/c9-4-1-2-5-6(3-4)8(11)12-7(5)10/h1-3H | | InChIKey | XVMKZAAFVWXIII-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=C(F)C=C2)C(=O)O1 | | CAS DataBase Reference | 319-03-9(CAS DataBase Reference) | | EPA Substance Registry System | 1,3-Isobenzofurandione, 5-fluoro- (319-03-9) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38-42/43 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 2 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HazardClass | IRRITANT, MOISTURE SENSITIVE | | PackingGroup | Ⅲ | | HS Code | 29173990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-Fluoro-1,3-isobenzofurandione Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 4-Fluorophthalic anhydride is used in the preparation of 5-fluoro-2-pyridin-3-ylmethyl-isoindole-1,3-dione by reacting with C-pyridin-3-yl-methylamine. | | Uses | 4-Fluorophthalic anhydride can be used as a reactant to prepare:
- 4-amino substituted phthalimides applicable as potential fluorescent probes and fluorescent bioactive compounds.
- 4,4′-bis(4-fluorophthalimido)diphenyl ether monomer, which is used in the synthesis of cardo polymers via nucleophilic substitution polymerization reaction.
- Asymmetric polyimides by a solution polycondensation reaction.
| | General Description | 4-Fluorophthalic anhydride is a fluorinated building block commonly used in chemical synthesis for the preparation of polyimide, pesticides, herbicides, and fungicides. It can be synthesized by treating 4-chlorophthalic anhydride with potassium fluoride. |
| | 5-Fluoro-1,3-isobenzofurandione Preparation Products And Raw materials |
|