|
|
| | 3,4-DIMETHOXYBENZOYL CHLORIDE Basic information |
| Product Name: | 3,4-DIMETHOXYBENZOYL CHLORIDE | | Synonyms: | 3,4-DIMETHOXYBENZENE-1-CARBONYL CHLORIDE;3,4-DIMETHOXYBENZOYL CHLORIDE;BUTTPARK 94\04-06;3,4-Dimethoxybenzoyl chloride ,98%;3,4-Dimethoxybenzoic acid chloride;3,4-Dimethoxy-1-benzenecarbonyl chloride;Itopride Impurity 11;3,4-DiMethoxybenzoyl chloride, 98% 5GR | | CAS: | 3535-37-3 | | MF: | C9H9ClO3 | | MW: | 200.62 | | EINECS: | 222-568-0 | | Product Categories: | Aromatic Halides (substituted) | | Mol File: | 3535-37-3.mol |  |
| | 3,4-DIMETHOXYBENZOYL CHLORIDE Chemical Properties |
| Melting point | 70-73 °C (lit.) | | Boiling point | 95-98°C 1mm | | density | 1.2799 (rough estimate) | | refractive index | 1.5230 (estimate) | | Fp | 95-98°C/1mm | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Toluene | | form | Crystals, Flakes or Chunks | | color | Off-white to gray | | Sensitive | Moisture Sensitive | | BRN | 783596 | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C9H9ClO3/c1-12-7-4-3-6(9(10)11)5-8(7)13-2/h3-5H,1-2H3 | | InChIKey | VIOBGCWEHLRBEP-UHFFFAOYSA-N | | SMILES | C(Cl)(=O)C1=CC=C(OC)C(OC)=C1 | | CAS DataBase Reference | 3535-37-3(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29222990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 3,4-DIMETHOXYBENZOYL CHLORIDE Usage And Synthesis |
| Chemical Properties | off-white to grey crystals, flakes or chunks | | Uses | 3,4-Dimethoxybenzoyl Chloride is a benzoyl chloride derivative used in the preparation of a variety of biologically active compounds such as bronchodilators | | Uses | 3,4-Dimethoxybenzoyl chloride has been used in synthesis of:
- (+)-5-(3,4-dimethoxyphenyl)-4-[[N-[(4S)-2-oxo-4-(phenylmethyl)-2-oxazolidinyl]]carbonyl] oxazole and its enantiomer
- N-(2,5-dibromophenyl)-3,4-dimethoxybenzamide
|
| | 3,4-DIMETHOXYBENZOYL CHLORIDE Preparation Products And Raw materials |
|