- 4-tert-Butylbenzonitrile
-
- $15.00 / 1KG
-
2021-07-13
- CAS:4210-32-6
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 4-tert-Butylbenzonitrile Basic information |
| | 4-tert-Butylbenzonitrile Chemical Properties |
| Melting point | 12-14 °C | | Boiling point | 258 °C(lit.) | | density | 0.94 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.518(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow | | Specific Gravity | 0.95 | | BRN | 2080049 | | InChI | InChI=1S/C11H13N/c1-11(2,3)10-6-4-9(8-12)5-7-10/h4-7H,1-3H3 | | InChIKey | IIZURLNRIMKEDL-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=C(C(C)(C)C)C=C1 | | LogP | 3.49 | | CAS DataBase Reference | 4210-32-6(CAS DataBase Reference) | | NIST Chemistry Reference | 4-t-Butylbenzonitrile(4210-32-6) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22 | | Safety Statements | 36-36/37 | | RIDADR | 3276 | | WGK Germany | 2 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4-tert-Butylbenzonitrile Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | 4-tert-Butylbenzonitrile may be used to synthesize 3-bromo-4′-tert-butylbenzophenone. | | General Description | 4-tert-Butylbenzonitrile can be prepared from 4-tert-butyl-1,2-dihydrobenzene, via dehydrogenation. |
| | 4-tert-Butylbenzonitrile Preparation Products And Raw materials |
|