| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
2-(2-fluorophenyl)-6,7-methylenedioxy-2-4-quinolone hydrate, NSC 656158 manufacturers
- CHM-1
-
- $33.00
-
2026-04-22
- CAS:154554-41-3
- Purity: 99.83%
- Supply Ability: 10g
|
| | 2-(2-fluorophenyl)-6,7-methylenedioxy-2-4-quinolone hydrate, NSC 656158 Basic information |
| Product Name: | 2-(2-fluorophenyl)-6,7-methylenedioxy-2-4-quinolone hydrate, NSC 656158 | | Synonyms: | 2-(2-fluorophenyl)-6,7-methylenedioxy-2-4-quinolone hydrate, NSC 656158;CHM-1 hydrate;6-(2-Fluorophenyl)-1,3-dioxolo[4,5-g]quinolin-8(5H)-one;CHM 1;2-(2-fluorophenyl)-6,7-methylenedioxy-2-4-quinolone hydrate;NSC 656158;6-(2-Fluoro-phenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-8-one;1,3-Dioxolo[4,5-g]quinolin-8(5H)-one, 6-(2-fluorophenyl)- | | CAS: | 154554-41-3 | | MF: | C16H10FNO3 | | MW: | 283.25 | | EINECS: | | | Product Categories: | | | Mol File: | 154554-41-3.mol |  |
| | 2-(2-fluorophenyl)-6,7-methylenedioxy-2-4-quinolone hydrate, NSC 656158 Chemical Properties |
| storage temp. | 2-8°C | | solubility | DMSO: ≥5mg/mL | | form | solid | | color | Off-white to light yellow | | InChI | 1S/C16H10FNO3.H2O/c17-11-4-2-1-3-9(11)12-6-14(19)10-5-15-16(21-8-20-15)7-13(10)18-12;/h1-7H,8H2,(H,18,19);1H2 | | InChIKey | KIAVGSCBJYDTIM-UHFFFAOYSA-N | | SMILES | O.Fc1ccccc1C2=CC(=O)c3cc4OCOc4cc3N2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 2-(2-fluorophenyl)-6,7-methylenedioxy-2-4-quinolone hydrate, NSC 656158 Usage And Synthesis |
| Uses | CHM-1 is a potent apoptosis inducer. | | Biological Activity | CHM-1 possess antimitotic,antiangiogenic and antitumor activity. It is a potent and selective antitumor agent in human hepatocellular carcinoma. CHM-1 induces apoptosis, and it binds tubulin and inhibits tubulin polymerization. |
| | 2-(2-fluorophenyl)-6,7-methylenedioxy-2-4-quinolone hydrate, NSC 656158 Preparation Products And Raw materials |
|