|
|
| | 3-Amino-2-methoxybenzoic acid Basic information |
| | 3-Amino-2-methoxybenzoic acid Chemical Properties |
| Melting point | 98-102 °C | | Boiling point | 353.3±27.0 °C(Predicted) | | density | 1.303±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 3.23±0.10(Predicted) | | color | White to Brown | | Major Application | peptide synthesis | | InChI | InChI=1S/C8H9NO3/c1-12-7-5(8(10)11)3-2-4-6(7)9/h2-4H,9H2,1H3,(H,10,11) | | InChIKey | ZBQFWVIYNLHFMO-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC(N)=C1OC |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-Amino-2-methoxybenzoic acid Usage And Synthesis |
| Physical properties | White to brown solid
| | Uses | 3-Amino-2-methoxybenzoic acid is used in peptide synthesis and assay.
| | reaction suitability | reaction type: solution phase peptide synthesis |
| | 3-Amino-2-methoxybenzoic acid Preparation Products And Raw materials |
|