|
|
| | 3-ACETYLBENZOPHENONE Basic information |
| | 3-ACETYLBENZOPHENONE Chemical Properties |
| Boiling point | 385.7±25.0 °C(Predicted) | | density | 1.126±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Pale Yellow to Light Yellow | | Major Application | pharmaceutical | | InChI | 1S/C15H12O2/c1-11(16)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-10H,1H3 | | InChIKey | PPNGALBGZJBTRY-UHFFFAOYSA-N | | SMILES | O=C(C)c1cc(ccc1)C(=O)c2ccccc2 |
| WGK Germany | WGK 3 | | HS Code | 2914500000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 2 |
| | 3-ACETYLBENZOPHENONE Usage And Synthesis |
| Uses | 3-Acetylbenzophenone (Ketoprofen EP Impurity A) is a Ketoprofen intermediate. Ketoprofen USP Related Compound D. |
| | 3-ACETYLBENZOPHENONE Preparation Products And Raw materials |
|