|
|
| | 1,4-DIETHOXY-2-NITROBENZENE Basic information |
| | 1,4-DIETHOXY-2-NITROBENZENE Chemical Properties |
| Melting point | 48-51 °C(lit.) | | Boiling point | 169 °C13 mm Hg(lit.) | | density | 1.2022 (estimate) | | refractive index | 1.5310 (estimate) | | Fp | >230 °F | | form | solid | | InChI | 1S/C10H13NO4/c1-3-14-8-5-6-10(15-4-2)9(7-8)11(12)13/h5-7H,3-4H2,1-2H3 | | InChIKey | AUCRWWWSFGZHBK-UHFFFAOYSA-N | | SMILES | CCOc1ccc(OCC)c(c1)[N+]([O-])=O | | CAS DataBase Reference | 119-23-3(CAS DataBase Reference) | | EPA Substance Registry System | Benzene, 1,4-diethoxy-2-nitro- (119-23-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-36 | | Safety Statements | 26-37/39 | | WGK Germany | 2 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 1,4-DIETHOXY-2-NITROBENZENE Usage And Synthesis |
| Uses | Reduction of 1,4-
diethoxy-2-nitrobenzene, yields 2,5-diethoxyaniline [94-85-9], which is used as an azo
coupling component or as the intermediate for
Fast Blue BB Base by consecutive benzoylation,
nitration, and reduction. | | Production Methods | 1,4-Diethoxybenzene is nitrated in a manner similar to the dimethyl ether
to give 1,4-
diethoxy-2-nitrobenzene. |
| | 1,4-DIETHOXY-2-NITROBENZENE Preparation Products And Raw materials |
|