|
|
| | Benzenesulfonic acid sodium salt Basic information |
| | Benzenesulfonic acid sodium salt Chemical Properties |
| Melting point | 450 °C | | density | 1.124 g/mL at 25 °C (lit.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | water: soluble | | form | Crystalline Powder | | color | White to off-white | | Water Solubility | soluble | | Sensitive | Hygroscopic | | Merck | 14,1070 | | BRN | 3918459 | | Stability: | Stable. Hygroscopic. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/C6H6O3S.Na.H/c7-10(8,9)6-4-2-1-3-5-6;;/h1-5H,(H,7,8,9);; | | InChIKey | MZSDGDXXBZSFTG-UHFFFAOYSA-M | | SMILES | S(C1C=CC=CC=1)(O)(=O)=O.[NaH] | | CAS DataBase Reference | 515-42-4(CAS DataBase Reference) | | EPA Substance Registry System | Benzenesulfonic acid, sodium salt (515-42-4) |
| | Benzenesulfonic acid sodium salt Usage And Synthesis |
| Chemical Properties | off-white crystalline powder | | Uses | Sodium benzenesulfonate has been used in Raman spectroscopic determination of molecular structural features in sulfonated polystyrene resins. It was used as electrolyte in formation of polypyrrole coatings with varying surface morphology on stainless steel. It was used in the synthesis of 1-butyl-3-propanenitrile imidazolium benzenesulfonate. | | Purification Methods | Crystallise it from EtOH or aqueous 70-100% MeOH, and dry it under a vacuum at 80-100o. [Beilstein 11 H 28, 11 I 10, 11 II 18, 11 III 33, 11 IV 27.] |
| | Benzenesulfonic acid sodium salt Preparation Products And Raw materials |
|