Polystyrene-β-poly(4-vinyl pyridine) manufacturers
|
| | Polystyrene-β-poly(4-vinyl pyridine) Basic information |
| | Polystyrene-β-poly(4-vinyl pyridine) Chemical Properties |
| form | powder | | Major Application | advanced drug delivery coatings | | InChI | InChI=1S/C8H8.C7H7N/c1-2-8-6-4-3-5-7-8;1-2-7-3-5-8-6-4-7/h2-7H,1H2;2-6H,1H2 | | InChIKey | CIPXQVPZUWMSQE-UHFFFAOYSA-N | | SMILES | C(C1C=CC=CC=1)=C.C(C1=CC=NC=C1)=C |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Polystyrene-β-poly(4-vinyl pyridine) Usage And Synthesis |
| Uses | Poly(4-vinylpyridine-co-styrene) can be used:- As a precursor in the preparation of ionic polymer with pendant photochromic moieties by reactingwith1,3,3-trimethyl-6μ-bromohexyloxyspiro[2H]-indol-2,3μ-[3H]-naphth[2,1-b][1,4]oxazine.
- As permselective membrane in the preparation of composite electrodes for glucose sensing.
- To prepare mixed redox polymer [RuIII(edta)(OH2)(py)]2[RuII(NH3)5(py)], which can switch into six redox states.
| | Solubility in organics | Cellosolve, chloroform, DMF |
| | Polystyrene-β-poly(4-vinyl pyridine) Preparation Products And Raw materials |
|