|
|
| | Heptafluorobutyric anhydride Basic information |
| | Heptafluorobutyric anhydride Chemical Properties |
| Melting point | −43 °C(lit.) | | Boiling point | 108-110 °C(lit.) | | density | 1.674 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.287(lit.) | | Fp | None | | storage temp. | room temp | | solubility | Miscible with halogenated solvents. Immiscible with polar solvents. | | form | Liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.653 | | Water Solubility | REACTS | | Sensitive | Hygroscopic | | BRN | 856036 | | Stability: | Moisture Sensitive | | InChI | 1S/C8F14O3/c9-3(10,5(13,14)7(17,18)19)1(23)25-2(24)4(11,12)6(15,16)8(20,21)22 | | InChIKey | UFFSXJKVKBQEHC-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(=O)OC(=O)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 336-59-4(CAS DataBase Reference) | | NIST Chemistry Reference | Heptafluorobutyric anhydride(336-59-4) | | EPA Substance Registry System | Heptafluorobutyric anhydride (336-59-4) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | Hazard Note | Corrosive/Hygroscopic | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29159080 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Heptafluorobutyric anhydride Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | As a GC derivatizing agent, Heptafluorobutyric anhydride is used to prepare volatile derivatives of amino acids and other biologically active compounds. | | Uses | Heptafluorobutyric anhydride (HFAA) is frequently used as an acylating agent for the derivatization of primary and secondary amines (Walle and Ehrsson, 1971). Commercially available Heptafluorobutyric anhydride may afford low yields of the derivative due to the presence of Heptafluorobutyric acid (Moodie et al., 1985). This contaminant may be removed by ditillation over phosphorus pentoxide (Walle and Ehrsson, 1970).
HFAA is used to increase volatility of an analyte, and to introduce fluorine atoms for better detection limits in gas chromatography applications.
suzuki reaction | | Uses | Heptafluorobutyric anhydride is used as a derivatization reagent for gas chromatography - mass mass spectrometry analysis of the stereoisomer content of synthetic peptides. It is a GC derivatizing agent used to prepare volatile derivatives of amino acids and other biologically active compounds. | | Definition | ChEBI: An acyclic carboxylic anhydride that is perfluorinated butyric anhydride. It is used as a derivatising reagent for gas chromatographic analyses. | | General Description | Heptafluorobutyric anhydride is a perfluoroacylated acylation reagent, that forms stable, volatile derivatives with alcohols, amines, and phenols. It is majorly used to prepare electron-capturing derivatives for GC/electron capture detection. It is generally used with an acid scavenger, to help drive the reaction to completion and to prevent column damage from acidic by-products of the derivatization reaction. It is also used for the frequent testing of drugs of abuse such as, amphetamines and phencyclidine by GC-MS technique. | | reaction suitability | reagent type: derivatization reagent
reaction type: Acylations |
| | Heptafluorobutyric anhydride Preparation Products And Raw materials |
|