| Company Name: |
BePharm Ltd |
| Tel: |
400-685-9117 |
| Email: |
market@bepharm.com |
2-(Methylthio)-3-methylpyrimidine-4(3H)-one manufacturers
|
| | 2-(Methylthio)-3-methylpyrimidine-4(3H)-one Basic information |
| Product Name: | 2-(Methylthio)-3-methylpyrimidine-4(3H)-one | | Synonyms: | 2-(Methylthio)-3-methylpyrimidine-4(3H)-one;2-Methylthio-3-methyl-4(3H)-pyrimidone;2-Methylthio-3-methyl-4-pyrimidone;3-Methyl-2-(methylthio)pyrimidin-4(3H)-one;4(3H)-Pyrimidinone, 3-methyl-2-(methylthio)-;3-methyl-2-(methylsulfanyl)-3,4-dihydropyrimidin-
4-one;3-METHYL-2-(METHYLTHIO)-4(3H)-PYRIMIDINONE;Mizolastine Impurity 33 | | CAS: | 6327-98-6 | | MF: | C6H8N2OS | | MW: | 156.21 | | EINECS: | | | Product Categories: | | | Mol File: | 6327-98-6.mol |  |
| | 2-(Methylthio)-3-methylpyrimidine-4(3H)-one Chemical Properties |
| InChI | InChI=1S/C6H8N2OS/c1-8-5(9)3-4-7-6(8)10-2/h3-4H,1-2H3 | | InChIKey | BECYBYGJEOBJGE-UHFFFAOYSA-N | | SMILES | C1(SC)=NC=CC(=O)N1C |
| | 2-(Methylthio)-3-methylpyrimidine-4(3H)-one Usage And Synthesis |
| | 2-(Methylthio)-3-methylpyrimidine-4(3H)-one Preparation Products And Raw materials |
|