|
|
| | ETHYL 2-PROPYLPENTANOATE Basic information |
| Product Name: | ETHYL 2-PROPYLPENTANOATE | | Synonyms: | ETHYL 2-PROPYLPENTANOATE;valproic acid ethyl ester;Ethyl dipropylacetate;Pentanoic acid, 2-propyl-, ethyl ester;Valproic Acid Impurity 29;2-propylpentanoate ethyl ester;Ethyl valproate | | CAS: | 17022-31-0 | | MF: | C10H20O2 | | MW: | 172.26 | | EINECS: | | | Product Categories: | 1 | | Mol File: | 17022-31-0.mol |  |
| | ETHYL 2-PROPYLPENTANOATE Chemical Properties |
| Boiling point | 104 °C(Press: 32 Torr) | | density | 0.859 g/cm3(Temp: 24 °C) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C10H20O2/c1-4-7-9(8-5-2)10(11)12-6-3/h9H,4-8H2,1-3H3 | | InChIKey | WIKWUBHEBLFWHH-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(CCC)CCC |
| WGK Germany | WGK 2 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Skin Irrit. 2 |
| | ETHYL 2-PROPYLPENTANOATE Usage And Synthesis |
| Uses | Valproic Acid Ethyl Ester is the ethyl ester derivative of one of the major antiepileptic drugs, Valproic Acid (V094750). It has potential to be used as a biofuel, has a pleasant odor, and displays marked resistance to clouding and crystallization. |
| | ETHYL 2-PROPYLPENTANOATE Preparation Products And Raw materials |
|