|
|
| | 5-Amino-8-quinolinol dihydrochloride Basic information |
| | 5-Amino-8-quinolinol dihydrochloride Chemical Properties |
| Melting point | 279 °C (dec.)(lit.) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder to crystal | | color | Orange to Amber to Dark red | | Water Solubility | almost transparency | | InChI | 1S/C9H8N2O.2ClH/c10-7-3-4-8(12)9-6(7)2-1-5-11-9;;/h1-5,12H,10H2;2*1H | | InChIKey | VTQDJAUGGZFPOI-UHFFFAOYSA-N | | SMILES | Cl[H].Cl[H].Nc1ccc(O)c2ncccc12 | | CAS DataBase Reference | 21302-43-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-36 | | WGK Germany | 3 | | HS Code | 29334990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-Amino-8-quinolinol dihydrochloride Usage And Synthesis |
| Chemical Properties | Crystalline powder | | Uses | 5-Amino-8-hydroxyquinoline dihydrochloride was used in synthesis of:
- 5-acetamido-8-hydroxyquinoline hydrochloride
- 5-(p-tolylsulfonylimino)quinolin-8-one
- 5,8-quinolinesemiquinone via ferric chloride oxidation
| | Synthesis | Step 1: Preparation of 5-nitroso-8-hydroxyquinoline hydrochloride A solution of NaNO2 (30 g) in water (100 ml) was added to a mixture of 8-hydroxyquinoline (58 g, 0.4 mol) in distilled water, concentrated hydrochloric acid (75 ml) and ice (200 g) at 0-4C. The reaction mixture was kept at 0C overnight. Within 1 hr C. The reaction mixture was kept at 0 C. overnight and then filtered by washing with cold water to give 5-nitroso-8-hydroxyquinoline hydrochloride (95%). Step 2: Preparation of 5-amino-8-hydroxyquinoline dihydrochloride 5-Nitroso-8-hydroxyquinoline chloride (40 g) was added to a mixture of water (160 ml) and 5N-NaOH (260 ml) and heated to 40C. Na2S2O4 (95 g) was added to the reaction mixture and the temperature was raised to 75-80C. The reaction mixture was cooled to 50C and 12N-HCl (250 ml) was added. The reaction mixture was then cooled to 0 C and filtered to give 5-amino-8-hydroxyquinoline dihydrochloride (34 g, 69%). |
| | 5-Amino-8-quinolinol dihydrochloride Preparation Products And Raw materials |
|