|
|
| | Urolithin D Basic information |
| Product Name: | Urolithin D | | Synonyms: | 3,4,8,9-Tetrahydroxy-6H-dibenzo[b,d]pyran-6-one;Urolithin D;6H-Dibenzo[b,d]pyran-6-one, 3,4,8,9-tetrahydroxy-;3,4,8,9-Tetrahydroxy-6H-benzo[c]chromen-6-one | | CAS: | 131086-98-1 | | MF: | C13H8O6 | | MW: | 260.2 | | EINECS: | | | Product Categories: | | | Mol File: | 131086-98-1.mol |  |
| | Urolithin D Chemical Properties |
| Melting point | >260°C (dec.) | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Pale Grey | | Stability: | Hygroscopic | | InChI | 1S/C13H8O6/c14-8-2-1-5-6-3-9(15)10(16)4-7(6)13(18)19-12(5)11(8)17/h1-4,14-17H | | InChIKey | NEZDQSKPNPRYAW-UHFFFAOYSA-N | | SMILES | [o]1c2c(c3c([c]1=O)cc(c(c3)O)O)ccc(c2O)O | | LogP | 0.919 (est) |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Urolithin D Usage And Synthesis |
| Uses | Urolithin D is used in biological studies to evaluate DNA gyrase inhibitory activity of ellagic acid derivatives. | | Definition | ChEBI: Urolithin D is a hydroxycoumarin. |
| | Urolithin D Preparation Products And Raw materials |
|