|
|
| | 2',4'-Dimethylacetoacetanilide Basic information |
| | 2',4'-Dimethylacetoacetanilide Chemical Properties |
| Melting point | 88-91 °C(lit.) | | Boiling point | 343.93°C (rough estimate) | | density | 1.24 | | vapor pressure | 0-0.006Pa at 20-50℃ | | refractive index | 1.5160 (estimate) | | Fp | 171 °C | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 11.33±0.46(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C12H15NO2/c1-8-4-5-11(9(2)6-8)13-12(15)7-10(3)14/h4-6H,7H2,1-3H3,(H,13,15) | | InChIKey | HGVIAKXYAZRSEG-UHFFFAOYSA-N | | SMILES | C(NC1=CC=C(C)C=C1C)(=O)CC(=O)C | | LogP | 1.4 at 20℃ and pH6.5-7.5 | | CAS DataBase Reference | 97-36-9(CAS DataBase Reference) | | EPA Substance Registry System | Butanamide, N-(2,4-dimethylphenyl)-3-oxo- (97-36-9) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 24/25 | | WGK Germany | 1 | | RTECS | AK4585000 | | TSCA | TSCA listed | | HS Code | 29242998 | | Toxicity | LD50 orl-rat: 3000 mg/kg LONZA# 13JUL81 |
| | 2',4'-Dimethylacetoacetanilide Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | 2',4'-DiMethylacetoacetanilide is used as intermediate for the manufacture of organic pigments. | | Safety Profile | Moderately toxic by ingestion. When heated to decomposition it emits toxic vapors of NOx. |
| | 2',4'-Dimethylacetoacetanilide Preparation Products And Raw materials |
|