| Company Name: |
Hangzhou Dongyan Chemical Co., Ltd. Gold
|
| Tel: |
0571-85379092 13605811440 |
| Email: |
104652286@qq.com |
| Products Intro: |
Product Name:3-Methyl-1-phenethylbutylamine
CAS:6396-93-6
|
| Company Name: |
Shanghai Jiegu Biotechnology Co., Ltd.
|
| Tel: |
021-51698675 |
| Email: |
sales@jiejiegroup.com |
| Products Intro: |
Product Name:3-Methyl-1-phenethylbutylamine
CAS:6396-93-6
Purity:97% HPLC Package:100KG;1KG
|
| Company Name: |
Hubei Keyijia Chemical Co., Ltd.
|
| Tel: |
15629167229 |
| Email: |
1796273473@qq.com |
| Products Intro: |
Product Name:3-Methyl-1-phenethylbutylamine
CAS:6396-93-6
Purity:98% Package:25KG;5KG;1KG
|
|
| | 3-Methyl-1-phenethylbutylamine Basic information |
| Product Name: | 3-Methyl-1-phenethylbutylamine | | Synonyms: | 3-METHYL-1-PHENETHYL-BUTYLAMINE;2-METHYL-6-PHENYL-4-HEXYLAMINE;3-Amino-5-methyl-1-phenylhexane;α-(2-Methylpropyl)benzene-1-propanamine;[3-methyl-1-(2-phenylethyl)butyl]amine;5-methyl-1-phenyl-hexan-3-amine;5-methyl-1-phenylhexan-3-amine;Benzenepropanamine, α-(2-methylpropyl)- | | CAS: | 6396-93-6 | | MF: | C13H21N | | MW: | 191.31 | | EINECS: | 229-007-9 | | Product Categories: | | | Mol File: | 6396-93-6.mol |  |
| | 3-Methyl-1-phenethylbutylamine Chemical Properties |
| Boiling point | 145-148 °C(Press: 20 Torr) | | density | 0.914±0.06 g/cm3(Predicted) | | pka | 10.55±0.35(Predicted) | | InChI | InChI=1S/C13H21N/c1-11(2)10-13(14)9-8-12-6-4-3-5-7-12/h3-7,11,13H,8-10,14H2,1-2H3 | | InChIKey | CRTSWORLYAUHOJ-UHFFFAOYSA-N | | SMILES | C1(=CC=CC=C1)CCC(N)CC(C)C |
| | 3-Methyl-1-phenethylbutylamine Usage And Synthesis |
| | 3-Methyl-1-phenethylbutylamine Preparation Products And Raw materials |
|