|
|
| | 2-Amino-5-(4-fluorobenzyl)-1,3,4-thiadiazole Basic information |
| Product Name: | 2-Amino-5-(4-fluorobenzyl)-1,3,4-thiadiazole | | Synonyms: | 5-(4-FLUOROBENZYL)-1,3,4-THIADIAZOL-2-YLAMINE;5-(4-fluorobenzyl)-1,3,4-thiadiazol-2-amine;5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-amine;1,3,4-thiadiazol-2-amine, 5-[(4-fluorophenyl)methyl]-;2-Amino-5-(4-fluorobenzyl)-1,3,4-thiadiazole | | CAS: | 39181-55-0 | | MF: | C9H8FN3S | | MW: | 209.24 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 2-Amino-5-(4-fluorobenzyl)-1,3,4-thiadiazole Chemical Properties |
| Melting point | 205-207 °C(Solv: ethanol (64-17-5)) | | Boiling point | 390.0±44.0 °C(Predicted) | | density | 1.383±0.06 g/cm3(Predicted) | | pka | 3.33±0.10(Predicted) | | form | solid | | InChI | 1S/C9H8FN3S/c10-7-3-1-6(2-4-7)5-8-12-13-9(11)14-8/h1-4H,5H2,(H2,11,13) | | InChIKey | XHFWYSOJZBOIDC-UHFFFAOYSA-N | | SMILES | NC1=NN=C(CC2=CC=C(C=C2)F)S1 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2934100090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-Amino-5-(4-fluorobenzyl)-1,3,4-thiadiazole Usage And Synthesis |
| | 2-Amino-5-(4-fluorobenzyl)-1,3,4-thiadiazole Preparation Products And Raw materials |
|