PYROMELLITIC DIIMIDE manufacturers
- PYROMELLITIC DIIMIDE
-
- $350.00
-
2026-02-02
- CAS:2550-73-4
- Min. Order: 1KG
- Purity: 98%HPLC
- Supply Ability: 200tons
|
| | PYROMELLITIC DIIMIDE Basic information | | Uses |
| Product Name: | PYROMELLITIC DIIMIDE | | Synonyms: | LABOTEST-BB LT00080694;BENZENE-1,2,4,5-TETRACARBOXYLIC DIIMIDE;PYROMELLITIC DIIMIDE;benzene-1,2:4,5-tetracarboxydiimide;Benzene-1,2,4,5-tetracarbonylicdiimide;Benzene-1,2,4,5-tetracarboxylic diimide, Reillex(R) 402;1,2,4,5-Benzenetetracarboxylic acid 1,2:4,5-diimide;1,2:4,5-Benzenebis(dicarbimide) | | CAS: | 2550-73-4 | | MF: | C10H4N2O4 | | MW: | 216.15 | | EINECS: | 219-852-1 | | Product Categories: | | | Mol File: | 2550-73-4.mol |  |
| | PYROMELLITIC DIIMIDE Chemical Properties |
| Melting point | >320 °C(lit.) | | density | 1.64 g/cm3 | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 8.51±0.20(Predicted) | | color | White to Almost white | | BRN | 214780 | | InChI | InChI=1S/C10H4N2O4/c13-7-3-1-4-6(10(16)12-8(4)14)2-5(3)9(15)11-7/h1-2H,(H,11,13,15)(H,12,14,16) | | InChIKey | UGQZLDXDWSPAOM-UHFFFAOYSA-N | | SMILES | N1C(=O)C2=CC3=C(C=C2C1=O)C(=O)NC3=O | | LogP | 0.123 (est) | | CAS DataBase Reference | 2550-73-4(CAS DataBase Reference) | | EPA Substance Registry System | Benzo[1,2-c:4,5-c']dipyrrole-1,3,5,7(2H,6H)-tetrone (2550-73-4) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2925.19.4200 | | Storage Class | 11 - Combustible Solids |
| | PYROMELLITIC DIIMIDE Usage And Synthesis |
| Uses | PYROMELLITIC DIIMIDE is an amine organic compound that can be used as a fast-acting inhibitor of methanogenesis. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 24, p. 26, 1959 DOI: 10.1021/jo01083a008 |
| | PYROMELLITIC DIIMIDE Preparation Products And Raw materials |
|