- 4-Methylcinnamic acid
-
- $30.00 / 1g
-
2026-04-13
- CAS:1866-39-3
- Min. Order:
- Purity: 99.98%
- Supply Ability: 10g
- 4-Methylcinnamic acid
-
- $30.00 / 1g
-
2026-04-13
- CAS:1866-39-3
- Min. Order:
- Purity: 99.98%
- Supply Ability: 10g
- 4-Methylcinnamic acid
-
- $0.00 / 25kg
-
2026-04-09
- CAS:1866-39-3
- Min. Order: 25kg
- Purity: 99%
- Supply Ability: 300tons/year
|
| | 4-Methylcinnamic acid Basic information | | Uses |
| | 4-Methylcinnamic acid Chemical Properties |
| Melting point | 196-198 °C(lit.) | | Boiling point | 228.88°C (rough estimate) | | density | 1.0281 (rough estimate) | | refractive index | 1.5766 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.56(at 25℃) | | form | Fine Crystalline Powder | | color | White | | BRN | 1364327 | | InChI | InChI=1S/C10H10O2/c1-8-2-4-9(5-3-8)6-7-10(11)12/h2-7H,1H3,(H,11,12) | | InChIKey | RURHILYUWQEGOS-VOTSOKGWSA-N | | SMILES | C(O)(=O)C=CC1=CC=C(C)C=C1 | | LogP | 2.870 (est) | | CAS DataBase Reference | 1866-39-3(CAS DataBase Reference) | | NIST Chemistry Reference | P-methylcinnamic acid(1866-39-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36-26-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29163900 | | Storage Class | 11 - Combustible Solids |
| | 4-Methylcinnamic acid Usage And Synthesis |
| Uses | p-Methylcinnamic acid can be used in cosmetic fragrances and pharmaceutical intermediates. | | Chemical Properties | White fine crystalline powder | | Definition | ChEBI: 4-Methylcinnamic acid is a member of cinnamic acids. |
| | 4-Methylcinnamic acid Preparation Products And Raw materials |
|