|
|
| | 4-Cyclooctene-1-carboxylic acid Basic information |
| Product Name: | 4-Cyclooctene-1-carboxylic acid | | Synonyms: | 4-Cyclooctene-1-carboxylic acid;(Z)-Cyclooct-4-ene-1-carboxylic acid;(4Z)-cyclooct-4-ene-1-carboxylic acid;Cyclooct-4-enecarboxylic acid;4-Cyclooctenecarboxylic Acid;Cyclooct-4-ene-1-carboxylic acid;(Z)-cyclooct-4-enecarboxylic acid | | CAS: | 4103-10-0 | | MF: | C9H14O2 | | MW: | 154.21 | | EINECS: | | | Product Categories: | | | Mol File: | 4103-10-0.mol |  |
| | 4-Cyclooctene-1-carboxylic acid Chemical Properties |
| Boiling point | 118-120 °C(Press: 0.4 Torr) | | density | 1.045±0.06 g/cm3(Predicted) | | pka | 4.74±0.20(Predicted) | | InChI | InChI=1S/C9H14O2/c10-9(11)8-6-4-2-1-3-5-7-8/h1-2,8H,3-7H2,(H,10,11)/b2-1- | | InChIKey | KXJSFMMHUAFBLF-UPHRSURJSA-N | | SMILES | C1(C(O)=O)CCCC=CCC1 |c:7| |
| | 4-Cyclooctene-1-carboxylic acid Usage And Synthesis |
| Synthesis Reference(s) | Journal of the American Chemical Society, 78, p. 5129, 1956 DOI: 10.1021/ja01600a088 |
| | 4-Cyclooctene-1-carboxylic acid Preparation Products And Raw materials |
|