|
|
| | 3,5-Dihydroxyacetophenone Basic information |
| Product Name: | 3,5-Dihydroxyacetophenone | | Synonyms: | 3,5-DIHYDROXYACETOPHENONE;3,5-DIHYDROXYACETOPHENONE MONOHYDRATE;1-(3,5-dihydroxyphenyl)-ethanone;5-ACETYLRESORCINOL;3,5-Dihydroxyacetophemone;ETHANONE, 1-(3,5-DIHYDROXYPHENYL)-;1-(3,5-dihydroxyphenyl)ethan-1-one;3',5'-Dihydroxyacetophenone 3,5-Dihydroxyacetophenone | | CAS: | 51863-60-6 | | MF: | C8H8O3 | | MW: | 152.15 | | EINECS: | 257-480-1 | | Product Categories: | Building Blocks for Dendrimers;Functional Materials;Alcohols;Monomers;Polymer Science;FINE Chemical & INTERMEDIATES;Aromatic Acetophenones & Derivatives (substituted);bc0001 | | Mol File: | 51863-60-6.mol |  |
| | 3,5-Dihydroxyacetophenone Chemical Properties |
| Melting point | 145-146 °C(lit.) | | Boiling point | 234.6°C (rough estimate) | | density | 1.2143 (rough estimate) | | refractive index | 1.4447 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Powder | | pka | 8.63±0.10(Predicted) | | color | Off-white to brown | | BRN | 1936502 | | InChI | InChI=1S/C8H8O3/c1-5(9)6-2-7(10)4-8(11)3-6/h2-4,10-11H,1H3 | | InChIKey | WQXWIKCZNIGMAP-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC(O)=CC(O)=C1)C | | LogP | 1.019 (est) | | CAS DataBase Reference | 51863-60-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-36 | | WGK Germany | 3 | | HS Code | 29145090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3,5-Dihydroxyacetophenone Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 3',5'-Dihydroxyacetophenone is a dihydroxy derivative of acetophenone. 3',5'-Dihydroxyacetophenone shows inhibitory activity towards plant germination and growth as well as some antitumor activity. | | Uses | 3'',5''-Dihydroxyacetophenone is a dihydroxy derivative of acetophenone. 3'',5''-Dihydroxyacetophenone shows inhibitory activity towards plant germination and growth as well as some antitumor activity. | | Definition | ChEBI: 3',5'-Dihydroxyacetophenone is an aromatic ketone. | | Preparation | Preparation from 3,5-dimethoxyacetophenone (SM) by demethylation with aluminium chloride in refluxing chlorobenzene (71%) The starting material (SM) was prepared by a three-step procedure from 3,5-dimethoxy-benzoic acid. | | IC 50 | Human Endogenous Metabolite |
| | 3,5-Dihydroxyacetophenone Preparation Products And Raw materials |
|